C16H22IN — CID 65491102
1-(2-bicyclo[2.2.1]heptanyl)-N-[(4-iodophenyl)methyl]-N-methylmethanamine (PubChem CID 65491102) has the molecular formula C16H22IN and a molecular weight of 355.26 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-N-[(4-iodophenyl)methyl]-N-methylmethanamine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-[(4-iodophenyl)methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 65491102 |
| Molecular Formula | C16H22IN |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-[(4-iodophenyl)methyl]-N-methylmethanamine |
| SMILES | CN(Cc1ccc(I)cc1)CC1CC2CCC1C2 |
| InChI | InChI=1S/C16H22IN/c1-18(10-12-3-6-16(17)7-4-12)11-15-9-13-2-5-14(15)8-13/h3-4,6-7,13-15H,2,5,8-11H2,1H3 |
| InChIKey | NXRIORJDHRXJOD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|