C10H12BF4NO2 — CID 54970873
[5-fluoro-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]phenyl]boronic acid (PubChem CID 54970873) has the molecular formula C10H12BF4NO2 and a molecular weight of 265.01 g/mol. Its IUPAC name is [5-fluoro-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]phenyl]boronic acid.
| Compound Name | [5-fluoro-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 54970873 |
| Molecular Formula | C10H12BF4NO2 |
| Molecular Weight | 265.01 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [5-fluoro-2-[[methyl(2,2,2-trifluoroethyl)amino]methyl]phenyl]boronic acid |
| SMILES | CN(Cc1ccc(F)cc1B(O)O)CC(F)(F)F |
| InChI | InChI=1S/C10H12BF4NO2/c1-16(6-10(13,14)15)5-7-2-3-8(12)4-9(7)11(17)18/h2-4,17-18H,5-6H2,1H3 |
| InChIKey | JAHRJMRVVQLQGC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.01 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|