About 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea
1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea (PubChem CID 100687480) has the molecular formula C17H27N3O2S
and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea.
Molecular Properties
| Compound Name | 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea |
| PubChem CID | 100687480 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea |
| SMILES | O=C(NC[C@H]1CC[C@H](O)C1)NC1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C17H27N3O2S/c21-16-2-1-13(9-16)10-18-17(22)19-15-3-6-20(7-4-15)11-14-5-8-23-12-14/h5,8,12-13,15-16,21H,1-4,6-7,9-11H2,(H2,18,19,22)/t13-,16-/m0/s1 |
| InChIKey | JMRJRBZOHZTALH-BBRMVZONSA-N |
| XLogP | 2.17 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea?
The IUPAC name of 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea (CID 100687480) is 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea.
What is the SMILES notation for 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea?
The canonical SMILES for 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea is O=C(NC[C@H]1CC[C@H](O)C1)NC1CCN(Cc2ccsc2)CC1.
What is the InChIKey of 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea?
The InChIKey is JMRJRBZOHZTALH-BBRMVZONSA-N. The full InChI is InChI=1S/C17H27N3O2S/c21-16-2-1-13(9-16)10-18-17(22)19-15-3-6-20(7-4-15)11-14-5-8-23-12-14/h5,8,12-13,15-16,21H,1-4,6-7,9-11H2,(H2,18,19,22)/t13-,16-/m0/s1.
What are the key properties of 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea?
1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea has a molecular weight of 337.49 g/mol, XLogP of 2.17, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1S,3S)-3-hydroxycyclopentyl]methyl]-3-[1-(thiophen-3-ylmethyl)piperidin-4-yl]urea is sourced from PubChem (CID 100687480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).