C20H39NO4P+ — CID 10068811
2-[5-(2-adamantyl)pentoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 10068811) has the molecular formula C20H39NO4P+ and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[5-(2-adamantyl)pentoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[5-(2-adamantyl)pentoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 10068811 |
| Molecular Formula | C20H39NO4P+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[5-(2-adamantyl)pentoxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)OCCCCCC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H38NO4P/c1-21(2,3)8-10-25-26(22,23)24-9-6-4-5-7-20-18-12-16-11-17(14-18)15-19(20)13-16/h16-20H,4-15H2,1-3H3/p+1 |
| InChIKey | UHUCPXIUBAMVEE-UHFFFAOYSA-O |
| XLogP | 4.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|