C24H30N2O5 — CID 100688133
(1S,2R,3R,4S)-3-[[(4-cyclopentyloxybenzoyl)amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 100688133) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-[[(4-cyclopentyloxybenzoyl)amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4S)-3-[[(4-cyclopentyloxybenzoyl)amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 100688133 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (1S,2R,3R,4S)-3-[[(4-cyclopentyloxybenzoyl)amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)=C1[C@H]2CC[C@H]1[C@@H](C(=O)NNC(=O)c1ccc(OC3CCCC3)cc1)[C@@H]2C(=O)O |
| InChI | InChI=1S/C24H30N2O5/c1-13(2)19-17-11-12-18(19)21(24(29)30)20(17)23(28)26-25-22(27)14-7-9-16(10-8-14)31-15-5-3-4-6-15/h7-10,15,17-18,20-21H,3-6,11-12H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)/t17-,18-,20-,21-/m1/s1 |
| InChIKey | GLNXKIXFDSNTLS-VURPSTOHSA-N |
| XLogP | 3.46 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|