C25H34N2O4S — CID 51434071
(1S,2S,3R,4R)-3-[[[(6S)-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 51434071) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[[(6S)-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-[[[(6S)-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 51434071 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[[(6S)-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl]amino]carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@@H](C(=O)NNC(=O)c1csc3c1CC[C@H](C(C)(C)C)C3)[C@H]2C(=O)O |
| InChI | InChI=1S/C25H34N2O4S/c1-12(2)19-15-8-9-16(19)21(24(30)31)20(15)23(29)27-26-22(28)17-11-32-18-10-13(25(3,4)5)6-7-14(17)18/h11,13,15-16,20-21H,6-10H2,1-5H3,(H,26,28)(H,27,29)(H,30,31)/t13-,15-,16+,20+,21-/m0/s1 |
| InChIKey | YOESVLDFVRCLOS-QYOVSDOKSA-N |
| XLogP | 4.35 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|