C13H17ClOS — CID 82341869
6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl chloride (PubChem CID 82341869) has the molecular formula C13H17ClOS and a molecular weight of 256.80 g/mol. Its IUPAC name is 6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl chloride.
| Compound Name | 6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl chloride |
|---|---|
| PubChem CID | 82341869 |
| Molecular Formula | C13H17ClOS |
| Molecular Weight | 256.80 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonyl chloride |
| SMILES | CC(C)(C)C1CCc2c(C(=O)Cl)csc2C1 |
| InChI | InChI=1S/C13H17ClOS/c1-13(2,3)8-4-5-9-10(12(14)15)7-16-11(9)6-8/h7-8H,4-6H2,1-3H3 |
| InChIKey | JIOMXEXETITAAS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|