C18H18N2OS2 — CID 100690877
N-[(2S)-2-(azetidin-1-yl)-2-thiophen-3-ylethyl]-1-benzothiophene-2-carboxamide (PubChem CID 100690877) has the molecular formula C18H18N2OS2 and a molecular weight of 342.49 g/mol. Its IUPAC name is N-[(2S)-2-(azetidin-1-yl)-2-thiophen-3-ylethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(2S)-2-(azetidin-1-yl)-2-thiophen-3-ylethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 100690877 |
| Molecular Formula | C18H18N2OS2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[(2S)-2-(azetidin-1-yl)-2-thiophen-3-ylethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC[C@H](c1ccsc1)N1CCC1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H18N2OS2/c21-18(17-10-13-4-1-2-5-16(13)23-17)19-11-15(20-7-3-8-20)14-6-9-22-12-14/h1-2,4-6,9-10,12,15H,3,7-8,11H2,(H,19,21)/t15-/m1/s1 |
| InChIKey | OWQZOKFAHAIYQK-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |