C15H19ClN2O3S — CID 100691019
1-[(3-chloro-4-methylsulfonylphenyl)methyl]-3-[(3R)-4-methylpent-1-yn-3-yl]urea (PubChem CID 100691019) has the molecular formula C15H19ClN2O3S and a molecular weight of 342.85 g/mol. Its IUPAC name is 1-[(3-chloro-4-methylsulfonylphenyl)methyl]-3-[(3R)-4-methylpent-1-yn-3-yl]urea.
| Compound Name | 1-[(3-chloro-4-methylsulfonylphenyl)methyl]-3-[(3R)-4-methylpent-1-yn-3-yl]urea |
|---|---|
| PubChem CID | 100691019 |
| Molecular Formula | C15H19ClN2O3S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 1-[(3-chloro-4-methylsulfonylphenyl)methyl]-3-[(3R)-4-methylpent-1-yn-3-yl]urea |
| SMILES | C#C[C@H](NC(=O)NCc1ccc(S(C)(=O)=O)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C15H19ClN2O3S/c1-5-13(10(2)3)18-15(19)17-9-11-6-7-14(12(16)8-11)22(4,20)21/h1,6-8,10,13H,9H2,2-4H3,(H2,17,18,19)/t13-/m0/s1 |
| InChIKey | BAEFVTGWWWSCCQ-ZDUSSCGKSA-N |
| XLogP | 2.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|