C20H17ClFNO2S2 — CID 100692131
N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 100692131) has the molecular formula C20H17ClFNO2S2 and a molecular weight of 421.95 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 100692131 |
| Molecular Formula | C20H17ClFNO2S2 |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)Nc1ccccc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClFNO2S2/c1-14-12-17(22)10-11-20(14)27(24,25)23-18-4-2-3-5-19(18)26-13-15-6-8-16(21)9-7-15/h2-12,23H,13H2,1H3 |
| InChIKey | DJLMICPDLTYSCM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |