C31H29ClN4O6S — CID 100693146
(2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 100693146) has the molecular formula C31H29ClN4O6S and a molecular weight of 621.12 g/mol. Its IUPAC name is (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100693146 |
| Molecular Formula | C31H29ClN4O6S |
| Molecular Weight | 621.12 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | (2R)-2-[[2-[N-(benzenesulfonyl)-3-nitroanilino]acetyl]-[(2-chlorophenyl)methyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H29ClN4O6S/c1-33-31(38)29(19-23-11-4-2-5-12-23)34(21-24-13-8-9-18-28(24)32)30(37)22-35(25-14-10-15-26(20-25)36(39)40)43(41,42)27-16-6-3-7-17-27/h2-18,20,29H,19,21-22H2,1H3,(H,33,38)/t29-/m1/s1 |
| InChIKey | OCVVPJOEJCTLMI-GDLZYMKVSA-N |
| XLogP | 4.83 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.12 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|