C22H24N2O3S — CID 10069331
N,N-diethyl-4,5-bis(4-methoxyphenyl)-1,3-thiazole-2-carboxamide (PubChem CID 10069331) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N,N-diethyl-4,5-bis(4-methoxyphenyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N,N-diethyl-4,5-bis(4-methoxyphenyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 10069331 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N,N-diethyl-4,5-bis(4-methoxyphenyl)-1,3-thiazole-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C22H24N2O3S/c1-5-24(6-2)22(25)21-23-19(15-7-11-17(26-3)12-8-15)20(28-21)16-9-13-18(27-4)14-10-16/h7-14H,5-6H2,1-4H3 |
| InChIKey | IWXRUBAFTUZKFB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |