C13H13BrF3NO3 — CID 100696495
methyl (2R)-2-[(4-bromo-2-methylbenzoyl)amino]-4,4,4-trifluorobutanoate (PubChem CID 100696495) has the molecular formula C13H13BrF3NO3 and a molecular weight of 368.15 g/mol. Its IUPAC name is methyl (2R)-2-[(4-bromo-2-methylbenzoyl)amino]-4,4,4-trifluorobutanoate.
| Compound Name | methyl (2R)-2-[(4-bromo-2-methylbenzoyl)amino]-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 100696495 |
| Molecular Formula | C13H13BrF3NO3 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | methyl (2R)-2-[(4-bromo-2-methylbenzoyl)amino]-4,4,4-trifluorobutanoate |
| SMILES | COC(=O)[C@@H](CC(F)(F)F)NC(=O)c1ccc(Br)cc1C |
| InChI | InChI=1S/C13H13BrF3NO3/c1-7-5-8(14)3-4-9(7)11(19)18-10(12(20)21-2)6-13(15,16)17/h3-5,10H,6H2,1-2H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | ZWUSIUCQTAZBEJ-SNVBAGLBSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |