C20H16F3NO2S — CID 100700044
4-thiophen-3-yl-N-[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropyl]benzamide (PubChem CID 100700044) has the molecular formula C20H16F3NO2S and a molecular weight of 391.41 g/mol. Its IUPAC name is 4-thiophen-3-yl-N-[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropyl]benzamide.
| Compound Name | 4-thiophen-3-yl-N-[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 100700044 |
| Molecular Formula | C20H16F3NO2S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 4-thiophen-3-yl-N-[(2S)-3,3,3-trifluoro-2-hydroxy-2-phenylpropyl]benzamide |
| SMILES | O=C(NC[C@@](O)(c1ccccc1)C(F)(F)F)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C20H16F3NO2S/c21-20(22,23)19(26,17-4-2-1-3-5-17)13-24-18(25)15-8-6-14(7-9-15)16-10-11-27-12-16/h1-12,26H,13H2,(H,24,25)/t19-/m1/s1 |
| InChIKey | GNVCQYKOWVDORS-LJQANCHMSA-N |
| XLogP | 4.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |