C18H18N2O2S — CID 100702680
N-[(Z)-3-(cyclopropylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide (PubChem CID 100702680) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[(Z)-3-(cyclopropylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide.
| Compound Name | N-[(Z)-3-(cyclopropylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 100702680 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[(Z)-3-(cyclopropylamino)-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N/C(=C\c1cccs1)C(=O)NC1CC1 |
| InChI | InChI=1S/C18H18N2O2S/c1-12-5-2-3-7-15(12)17(21)20-16(11-14-6-4-10-23-14)18(22)19-13-8-9-13/h2-7,10-11,13H,8-9H2,1H3,(H,19,22)(H,20,21)/b16-11- |
| InChIKey | WPGBXEZCWDZNJY-WJDWOHSUSA-N |
| XLogP | 3.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|