C22H24N2O2S — CID 125063861
N-[(Z)-3-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide (PubChem CID 125063861) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[(Z)-3-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide.
| Compound Name | N-[(Z)-3-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 125063861 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[(Z)-3-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N/C(=C\c1cccs1)C(=O)N[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C22H24N2O2S/c1-14-5-2-3-7-18(14)21(25)24-20(13-17-6-4-10-27-17)22(26)23-19-12-15-8-9-16(19)11-15/h2-7,10,13,15-16,19H,8-9,11-12H2,1H3,(H,23,26)(H,24,25)/b20-13-/t15-,16-,19-/m0/s1 |
| InChIKey | GILTVILCWANLOK-PMUQWRBBSA-N |
| XLogP | 4.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|