C23H30N2O2S — CID 100547536
N-[(Z)-3-[[(2S)-2-ethylhexyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide (PubChem CID 100547536) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is N-[(Z)-3-[[(2S)-2-ethylhexyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide.
| Compound Name | N-[(Z)-3-[[(2S)-2-ethylhexyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 100547536 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[(Z)-3-[[(2S)-2-ethylhexyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-2-methylbenzamide |
| SMILES | CCCC[C@H](CC)CNC(=O)/C(=C/c1cccs1)NC(=O)c1ccccc1C |
| InChI | InChI=1S/C23H30N2O2S/c1-4-6-11-18(5-2)16-24-23(27)21(15-19-12-9-14-28-19)25-22(26)20-13-8-7-10-17(20)3/h7-10,12-15,18H,4-6,11,16H2,1-3H3,(H,24,27)(H,25,26)/b21-15-/t18-/m0/s1 |
| InChIKey | USMUIVKPLJGZEP-IGCAKMCNSA-N |
| XLogP | 5.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|