C21H33NO3 — CID 100707392
trans-(1S,3R)-N-(4-butoxy-3,5-dimethylphenyl)-1-methoxy-3-methylcyclohexane-1-carboxamide (PubChem CID 100707392) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is trans-(1S,3R)-N-(4-butoxy-3,5-dimethylphenyl)-1-methoxy-3-methylcyclohexane-1-carboxamide.
| Compound Name | trans-(1S,3R)-N-(4-butoxy-3,5-dimethylphenyl)-1-methoxy-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100707392 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | trans-(1S,3R)-N-(4-butoxy-3,5-dimethylphenyl)-1-methoxy-3-methylcyclohexane-1-carboxamide |
| SMILES | CCCCOc1c(C)cc(NC(=O)[C@]2(OC)CCC[C@@H](C)C2)cc1C |
| InChI | InChI=1S/C21H33NO3/c1-6-7-11-25-19-16(3)12-18(13-17(19)4)22-20(23)21(24-5)10-8-9-15(2)14-21/h12-13,15H,6-11,14H2,1-5H3,(H,22,23)/t15-,21+/m1/s1 |
| InChIKey | KXIICYHDOIYNET-VFNWGFHPSA-N |
| XLogP | 5.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|