C33H41BrN2O4 — CID 100711383
(2R)-2-[[2-(2-bromo-4-tert-butylphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100711383) has the molecular formula C33H41BrN2O4 and a molecular weight of 609.61 g/mol. Its IUPAC name is (2R)-2-[[2-(2-bromo-4-tert-butylphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[[2-(2-bromo-4-tert-butylphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100711383 |
| Molecular Formula | C33H41BrN2O4 |
| Molecular Weight | 609.61 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | (2R)-2-[[2-(2-bromo-4-tert-butylphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)COc1ccc(C(C)(C)C)cc1Br |
| InChI | InChI=1S/C33H41BrN2O4/c1-6-7-18-35-32(38)29(20-24-12-9-8-10-13-24)36(22-25-14-11-15-27(19-25)39-5)31(37)23-40-30-17-16-26(21-28(30)34)33(2,3)4/h8-17,19,21,29H,6-7,18,20,22-23H2,1-5H3,(H,35,38)/t29-/m1/s1 |
| InChIKey | IIMLKIMNVBIXNU-GDLZYMKVSA-N |
| XLogP | 6.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|