C33H42N2O4 — CID 100713001
(2S)-N-butyl-2-[[2-(2-tert-butylphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100713001) has the molecular formula C33H42N2O4 and a molecular weight of 530.71 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(2-tert-butylphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(2-tert-butylphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100713001 |
| Molecular Formula | C33H42N2O4 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(2-tert-butylphenoxy)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C33H42N2O4/c1-6-7-20-34-32(37)29(22-25-14-9-8-10-15-25)35(23-26-16-13-17-27(21-26)38-5)31(36)24-39-30-19-12-11-18-28(30)33(2,3)4/h8-19,21,29H,6-7,20,22-24H2,1-5H3,(H,34,37)/t29-/m0/s1 |
| InChIKey | BBHBARKQBNQSIK-LJAQVGFWSA-N |
| XLogP | 5.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|