C26H48O3Si — CID 10071736
(6E,10E,14E)-5-[tert-butyl(dimethyl)silyl]oxy-16-hydroxy-2,6,10,14-tetramethylhexadeca-6,10,14-trien-3-one (PubChem CID 10071736) has the molecular formula C26H48O3Si and a molecular weight of 436.75 g/mol. Its IUPAC name is (6E,10E,14E)-5-[tert-butyl(dimethyl)silyl]oxy-16-hydroxy-2,6,10,14-tetramethylhexadeca-6,10,14-trien-3-one.
| Compound Name | (6E,10E,14E)-5-[tert-butyl(dimethyl)silyl]oxy-16-hydroxy-2,6,10,14-tetramethylhexadeca-6,10,14-trien-3-one |
|---|---|
| PubChem CID | 10071736 |
| Molecular Formula | C26H48O3Si |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.34 |
| IUPAC Name | (6E,10E,14E)-5-[tert-butyl(dimethyl)silyl]oxy-16-hydroxy-2,6,10,14-tetramethylhexadeca-6,10,14-trien-3-one |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)C(CC(=O)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O3Si/c1-20(2)24(28)19-25(29-30(9,10)26(6,7)8)23(5)16-12-15-21(3)13-11-14-22(4)17-18-27/h13,16-17,20,25,27H,11-12,14-15,18-19H2,1-10H3/b21-13+,22-17+,23-16+ |
| InChIKey | VAXFNIKUJZCBLU-ZHKUUZJBSA-N |
| XLogP | 7.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|