C30H33NO2 — CID 10071910
6-(2-methoxyphenyl)-2,2-dimethyl-4-(3-phenyl-1-prop-2-enoxypropyl)-1H-quinoline (PubChem CID 10071910) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-2,2-dimethyl-4-(3-phenyl-1-prop-2-enoxypropyl)-1H-quinoline.
| Compound Name | 6-(2-methoxyphenyl)-2,2-dimethyl-4-(3-phenyl-1-prop-2-enoxypropyl)-1H-quinoline |
|---|---|
| PubChem CID | 10071910 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 6-(2-methoxyphenyl)-2,2-dimethyl-4-(3-phenyl-1-prop-2-enoxypropyl)-1H-quinoline |
| SMILES | C=CCOC(CCc1ccccc1)C1=CC(C)(C)Nc2ccc(-c3ccccc3OC)cc21 |
| InChI | InChI=1S/C30H33NO2/c1-5-19-33-29(18-15-22-11-7-6-8-12-22)26-21-30(2,3)31-27-17-16-23(20-25(26)27)24-13-9-10-14-28(24)32-4/h5-14,16-17,20-21,29,31H,1,15,18-19H2,2-4H3 |
| InChIKey | KPAXBIAZFPSKKK-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|