C19H29N5O3 — CID 100720101
1-[5,6-dimethyl-7-[[(2S)-oxolan-2-yl]methyl]pyrrolo[2,3-d]pyrimidin-4-yl]-3-(4-methoxybutyl)urea (PubChem CID 100720101) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[5,6-dimethyl-7-[[(2S)-oxolan-2-yl]methyl]pyrrolo[2,3-d]pyrimidin-4-yl]-3-(4-methoxybutyl)urea.
| Compound Name | 1-[5,6-dimethyl-7-[[(2S)-oxolan-2-yl]methyl]pyrrolo[2,3-d]pyrimidin-4-yl]-3-(4-methoxybutyl)urea |
|---|---|
| PubChem CID | 100720101 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-[5,6-dimethyl-7-[[(2S)-oxolan-2-yl]methyl]pyrrolo[2,3-d]pyrimidin-4-yl]-3-(4-methoxybutyl)urea |
| SMILES | COCCCCNC(=O)Nc1ncnc2c1c(C)c(C)n2C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H29N5O3/c1-13-14(2)24(11-15-7-6-10-27-15)18-16(13)17(21-12-22-18)23-19(25)20-8-4-5-9-26-3/h12,15H,4-11H2,1-3H3,(H2,20,21,22,23,25)/t15-/m0/s1 |
| InChIKey | ILCPVWRNQOAUKM-HNNXBMFYSA-N |
| XLogP | 2.78 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|