C15H15Cl2NO2S — CID 100722892
2,5-dichloro-N-[2-[5-[(1R)-1-hydroxyethyl]thiophen-2-yl]ethyl]benzamide (PubChem CID 100722892) has the molecular formula C15H15Cl2NO2S and a molecular weight of 344.26 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[5-[(1R)-1-hydroxyethyl]thiophen-2-yl]ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[5-[(1R)-1-hydroxyethyl]thiophen-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 100722892 |
| Molecular Formula | C15H15Cl2NO2S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2,5-dichloro-N-[2-[5-[(1R)-1-hydroxyethyl]thiophen-2-yl]ethyl]benzamide |
| SMILES | C[C@@H](O)c1ccc(CCNC(=O)c2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C15H15Cl2NO2S/c1-9(19)14-5-3-11(21-14)6-7-18-15(20)12-8-10(16)2-4-13(12)17/h2-5,8-9,19H,6-7H2,1H3,(H,18,20)/t9-/m1/s1 |
| InChIKey | AUHPNBXAYJAUSZ-SECBINFHSA-N |
| XLogP | 4.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |