C22H37NO3 — CID 100725725
2-ethoxy-4-methyl-N-[4-(2-methylpropoxy)phenyl]-2-(2-methylpropyl)pentanamide (PubChem CID 100725725) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 2-ethoxy-4-methyl-N-[4-(2-methylpropoxy)phenyl]-2-(2-methylpropyl)pentanamide.
| Compound Name | 2-ethoxy-4-methyl-N-[4-(2-methylpropoxy)phenyl]-2-(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 100725725 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 2-ethoxy-4-methyl-N-[4-(2-methylpropoxy)phenyl]-2-(2-methylpropyl)pentanamide |
| SMILES | CCOC(CC(C)C)(CC(C)C)C(=O)Nc1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C22H37NO3/c1-8-26-22(13-16(2)3,14-17(4)5)21(24)23-19-9-11-20(12-10-19)25-15-18(6)7/h9-12,16-18H,8,13-15H2,1-7H3,(H,23,24) |
| InChIKey | GNGPZOCZVREGLL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |