C13H16N4O3S2 — CID 100725997
3-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methylsulfanyl]pyrazin-2-amine (PubChem CID 100725997) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 3-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methylsulfanyl]pyrazin-2-amine.
| Compound Name | 3-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methylsulfanyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 100725997 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methylsulfanyl]pyrazin-2-amine |
| SMILES | Nc1nccnc1SCc1ccc(S(=O)(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C13H16N4O3S2/c14-12-13(16-6-5-15-12)21-9-10-3-4-11(20-10)22(18,19)17-7-1-2-8-17/h3-6H,1-2,7-9H2,(H2,14,15) |
| InChIKey | JLABIPMHVYEVMH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |