C15H16F2N2O3S — CID 71998042
3,5-difluoro-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]aniline (PubChem CID 71998042) has the molecular formula C15H16F2N2O3S and a molecular weight of 342.37 g/mol. Its IUPAC name is 3,5-difluoro-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]aniline.
| Compound Name | 3,5-difluoro-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 71998042 |
| Molecular Formula | C15H16F2N2O3S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 3,5-difluoro-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]aniline |
| SMILES | O=S(=O)(c1ccc(CNc2cc(F)cc(F)c2)o1)N1CCCC1 |
| InChI | InChI=1S/C15H16F2N2O3S/c16-11-7-12(17)9-13(8-11)18-10-14-3-4-15(22-14)23(20,21)19-5-1-2-6-19/h3-4,7-9,18H,1-2,5-6,10H2 |
| InChIKey | CBAPLLXFSHFJAE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |