C19H25FN2O3S — CID 55838430
N-ethyl-1-(4-fluorophenyl)-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]ethanamine (PubChem CID 55838430) has the molecular formula C19H25FN2O3S and a molecular weight of 380.49 g/mol. Its IUPAC name is N-ethyl-1-(4-fluorophenyl)-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]ethanamine.
| Compound Name | N-ethyl-1-(4-fluorophenyl)-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 55838430 |
| Molecular Formula | C19H25FN2O3S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-ethyl-1-(4-fluorophenyl)-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]ethanamine |
| SMILES | CCN(Cc1ccc(S(=O)(=O)N2CCCC2)o1)C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN2O3S/c1-3-21(15(2)16-6-8-17(20)9-7-16)14-18-10-11-19(25-18)26(23,24)22-12-4-5-13-22/h6-11,15H,3-5,12-14H2,1-2H3 |
| InChIKey | YBMFYXVQSUWCSE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |