C15H24N2O5S — CID 47053734
methyl 2-methyl-3-[methyl-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]amino]propanoate (PubChem CID 47053734) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is methyl 2-methyl-3-[methyl-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]amino]propanoate.
| Compound Name | methyl 2-methyl-3-[methyl-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]amino]propanoate |
|---|---|
| PubChem CID | 47053734 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | methyl 2-methyl-3-[methyl-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]amino]propanoate |
| SMILES | COC(=O)C(C)CN(C)Cc1ccc(S(=O)(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C15H24N2O5S/c1-12(15(18)21-3)10-16(2)11-13-6-7-14(22-13)23(19,20)17-8-4-5-9-17/h6-7,12H,4-5,8-11H2,1-3H3 |
| InChIKey | YBTRJLGKYSSBFA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |