C16H22N2O3S2 — CID 55739537
N-methyl-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]-1-thiophen-2-ylethanamine (PubChem CID 55739537) has the molecular formula C16H22N2O3S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is N-methyl-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]-1-thiophen-2-ylethanamine.
| Compound Name | N-methyl-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 55739537 |
| Molecular Formula | C16H22N2O3S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-methyl-N-[(5-pyrrolidin-1-ylsulfonylfuran-2-yl)methyl]-1-thiophen-2-ylethanamine |
| SMILES | CC(c1cccs1)N(C)Cc1ccc(S(=O)(=O)N2CCCC2)o1 |
| InChI | InChI=1S/C16H22N2O3S2/c1-13(15-6-5-11-22-15)17(2)12-14-7-8-16(21-14)23(19,20)18-9-3-4-10-18/h5-8,11,13H,3-4,9-10,12H2,1-2H3 |
| InChIKey | FHQHTKNPPVBGME-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |