C21H19N5O3S2 — CID 10072616
N-[(E)-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 10072616) has the molecular formula C21H19N5O3S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[(E)-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-[(E)-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 10072616 |
| Molecular Formula | C21H19N5O3S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N-[(E)-(3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene)amino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CCN1C(=O)CS/C1=N/NC(=O)CSc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H19N5O3S2/c1-2-25-18(28)13-31-21(25)24-23-17(27)12-30-20-22-16-11-7-6-10-15(16)19(29)26(20)14-8-4-3-5-9-14/h3-11H,2,12-13H2,1H3,(H,23,27)/b24-21+ |
| InChIKey | FIASODIPSGZQJG-DARPEHSRSA-N |
| XLogP | 2.46 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|