C14H14N4O3S4 — CID 100727530
3-ethyl-2-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-benzothiazole-6-sulfonamide (PubChem CID 100727530) has the molecular formula C14H14N4O3S4 and a molecular weight of 414.56 g/mol. Its IUPAC name is 3-ethyl-2-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-benzothiazole-6-sulfonamide.
| Compound Name | 3-ethyl-2-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 100727530 |
| Molecular Formula | C14H14N4O3S4 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 3-ethyl-2-oxo-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-benzothiazole-6-sulfonamide |
| SMILES | C=CCSc1nnc(NS(=O)(=O)c2ccc3c(c2)sc(=O)n3CC)s1 |
| InChI | InChI=1S/C14H14N4O3S4/c1-3-7-22-13-16-15-12(24-13)17-25(20,21)9-5-6-10-11(8-9)23-14(19)18(10)4-2/h3,5-6,8H,1,4,7H2,2H3,(H,15,17) |
| InChIKey | TUDBTWSCOBLEFW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|