C14H17N3O3S3 — CID 100578806
4-methoxy-2,6-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 100578806) has the molecular formula C14H17N3O3S3 and a molecular weight of 371.51 g/mol. Its IUPAC name is 4-methoxy-2,6-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-methoxy-2,6-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 100578806 |
| Molecular Formula | C14H17N3O3S3 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 4-methoxy-2,6-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | C=CCSc1nnc(NS(=O)(=O)c2c(C)cc(OC)cc2C)s1 |
| InChI | InChI=1S/C14H17N3O3S3/c1-5-6-21-14-16-15-13(22-14)17-23(18,19)12-9(2)7-11(20-4)8-10(12)3/h5,7-8H,1,6H2,2-4H3,(H,15,17) |
| InChIKey | CTTLGJIVJREWRX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|