C10H12N4O3S3 — CID 100761214
3,5-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-4-sulfonamide (PubChem CID 100761214) has the molecular formula C10H12N4O3S3 and a molecular weight of 332.43 g/mol. Its IUPAC name is 3,5-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 100761214 |
| Molecular Formula | C10H12N4O3S3 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 3,5-dimethyl-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2-oxazole-4-sulfonamide |
| SMILES | C=CCSc1nnc(NS(=O)(=O)c2c(C)noc2C)s1 |
| InChI | InChI=1S/C10H12N4O3S3/c1-4-5-18-10-12-11-9(19-10)14-20(15,16)8-6(2)13-17-7(8)3/h4H,1,5H2,2-3H3,(H,11,14) |
| InChIKey | QWJFJRWAOIWCQT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|