C11H14N6O3S4 — CID 100585073
2-methyl-N-[5-[(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 100585073) has the molecular formula C11H14N6O3S4 and a molecular weight of 406.54 g/mol. Its IUPAC name is 2-methyl-N-[5-[(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-methyl-N-[5-[(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 100585073 |
| Molecular Formula | C11H14N6O3S4 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 2-methyl-N-[5-[(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | C=CCSc1nnc(NS(=O)(=O)c2nnc(NC(=O)C(C)C)s2)s1 |
| InChI | InChI=1S/C11H14N6O3S4/c1-4-5-21-10-15-14-9(22-10)17-24(19,20)11-16-13-8(23-11)12-7(18)6(2)3/h4,6H,1,5H2,2-3H3,(H,14,17)(H,12,13,18) |
| InChIKey | UGFCXHVTVGYNNH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|