C24H31NO3 — CID 100731535
1-ethoxy-N-(3-methyl-4-phenylmethoxyphenyl)cycloheptane-1-carboxamide (PubChem CID 100731535) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-ethoxy-N-(3-methyl-4-phenylmethoxyphenyl)cycloheptane-1-carboxamide.
| Compound Name | 1-ethoxy-N-(3-methyl-4-phenylmethoxyphenyl)cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 100731535 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 1-ethoxy-N-(3-methyl-4-phenylmethoxyphenyl)cycloheptane-1-carboxamide |
| SMILES | CCOC1(C(=O)Nc2ccc(OCc3ccccc3)c(C)c2)CCCCCC1 |
| InChI | InChI=1S/C24H31NO3/c1-3-28-24(15-9-4-5-10-16-24)23(26)25-21-13-14-22(19(2)17-21)27-18-20-11-7-6-8-12-20/h6-8,11-14,17H,3-5,9-10,15-16,18H2,1-2H3,(H,25,26) |
| InChIKey | HTUMVJJQMAWKDB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |