C22H34N2O5S — CID 100733823
tert-butyl (3R)-3-(4-ethylphenyl)-4-(4-methylsulfonylbutanoyl)piperazine-1-carboxylate (PubChem CID 100733823) has the molecular formula C22H34N2O5S and a molecular weight of 438.59 g/mol. Its IUPAC name is tert-butyl (3R)-3-(4-ethylphenyl)-4-(4-methylsulfonylbutanoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(4-ethylphenyl)-4-(4-methylsulfonylbutanoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 100733823 |
| Molecular Formula | C22H34N2O5S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | tert-butyl (3R)-3-(4-ethylphenyl)-4-(4-methylsulfonylbutanoyl)piperazine-1-carboxylate |
| SMILES | CCc1ccc([C@@H]2CN(C(=O)OC(C)(C)C)CCN2C(=O)CCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H34N2O5S/c1-6-17-9-11-18(12-10-17)19-16-23(21(26)29-22(2,3)4)13-14-24(19)20(25)8-7-15-30(5,27)28/h9-12,19H,6-8,13-16H2,1-5H3/t19-/m0/s1 |
| InChIKey | KDCQEIPMMDHTSL-IBGZPJMESA-N |
| XLogP | 3.19 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |