C25H28N4O2 — CID 175132846
tert-butyl 3,4-bis[4-(cyanomethyl)phenyl]piperazine-1-carboxylate (PubChem CID 175132846) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is tert-butyl 3,4-bis[4-(cyanomethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3,4-bis[4-(cyanomethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175132846 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | tert-butyl 3,4-bis[4-(cyanomethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(CC#N)cc2)C(c2ccc(CC#N)cc2)C1 |
| InChI | InChI=1S/C25H28N4O2/c1-25(2,3)31-24(30)28-16-17-29(22-10-6-20(7-11-22)13-15-27)23(18-28)21-8-4-19(5-9-21)12-14-26/h4-11,23H,12-13,16-18H2,1-3H3 |
| InChIKey | UQKPADRNSJYPDH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|