C37H36N4O2 — CID 175196255
tert-butyl 3,4-bis[4-(cyanomethyl)-2-phenylphenyl]piperazine-1-carboxylate (PubChem CID 175196255) has the molecular formula C37H36N4O2 and a molecular weight of 568.72 g/mol. Its IUPAC name is tert-butyl 3,4-bis[4-(cyanomethyl)-2-phenylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3,4-bis[4-(cyanomethyl)-2-phenylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175196255 |
| Molecular Formula | C37H36N4O2 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | tert-butyl 3,4-bis[4-(cyanomethyl)-2-phenylphenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(CC#N)cc2-c2ccccc2)C(c2ccc(CC#N)cc2-c2ccccc2)C1 |
| InChI | InChI=1S/C37H36N4O2/c1-37(2,3)43-36(42)40-22-23-41(34-17-15-28(19-21-39)25-33(34)30-12-8-5-9-13-30)35(26-40)31-16-14-27(18-20-38)24-32(31)29-10-6-4-7-11-29/h4-17,24-25,35H,18-19,22-23,26H2,1-3H3 |
| InChIKey | YPGQYOVCGBMASK-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 80.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |