C29H36N8O2 — CID 175218568
tert-butyl 3,4-bis[1-[4-(aminomethyl)phenyl]pyrazol-3-yl]piperazine-1-carboxylate (PubChem CID 175218568) has the molecular formula C29H36N8O2 and a molecular weight of 528.66 g/mol. Its IUPAC name is tert-butyl 3,4-bis[1-[4-(aminomethyl)phenyl]pyrazol-3-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 3,4-bis[1-[4-(aminomethyl)phenyl]pyrazol-3-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175218568 |
| Molecular Formula | C29H36N8O2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | tert-butyl 3,4-bis[1-[4-(aminomethyl)phenyl]pyrazol-3-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccn(-c3ccc(CN)cc3)n2)C(c2ccn(-c3ccc(CN)cc3)n2)C1 |
| InChI | InChI=1S/C29H36N8O2/c1-29(2,3)39-28(38)34-16-17-35(27-13-15-37(33-27)24-10-6-22(19-31)7-11-24)26(20-34)25-12-14-36(32-25)23-8-4-21(18-30)5-9-23/h4-15,26H,16-20,30-31H2,1-3H3 |
| InChIKey | PIQYIKWTQNNTHA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |