C20H24Cl4N2O — CID 143237932
3,4-bis(4-chlorophenyl)piperazine-1-carbonyl chloride;chloromethane;ethane (PubChem CID 143237932) has the molecular formula C20H24Cl4N2O and a molecular weight of 450.24 g/mol. Its IUPAC name is 3,4-bis(4-chlorophenyl)piperazine-1-carbonyl chloride;chloromethane;ethane.
| Compound Name | 3,4-bis(4-chlorophenyl)piperazine-1-carbonyl chloride;chloromethane;ethane |
|---|---|
| PubChem CID | 143237932 |
| Molecular Formula | C20H24Cl4N2O |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 3,4-bis(4-chlorophenyl)piperazine-1-carbonyl chloride;chloromethane;ethane |
| SMILES | CC.CCl.O=C(Cl)N1CCN(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H15Cl3N2O.C2H6.CH3Cl/c18-13-3-1-12(2-4-13)16-11-21(17(20)23)9-10-22(16)15-7-5-14(19)6-8-15;2*1-2/h1-8,16H,9-11H2;1-2H3;1H3 |
| InChIKey | UEFGNFCPLPFELE-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|