C24H28Cl2N2O — CID 143237619
[4-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-cyclohexylmethanone (PubChem CID 143237619) has the molecular formula C24H28Cl2N2O and a molecular weight of 431.41 g/mol. Its IUPAC name is [4-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-cyclohexylmethanone.
| Compound Name | [4-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 143237619 |
| Molecular Formula | C24H28Cl2N2O |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [4-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-cyclohexylmethanone |
| SMILES | Cc1cc(Cl)ccc1N1CCN(C(=O)C2CCCCC2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28Cl2N2O/c1-17-15-21(26)11-12-22(17)28-14-13-27(24(29)19-5-3-2-4-6-19)16-23(28)18-7-9-20(25)10-8-18/h7-12,15,19,23H,2-6,13-14,16H2,1H3 |
| InChIKey | IULABOLSDBNKCH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |