C26H24Cl2N2O — CID 143237622
(E)-1-[4-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 143237622) has the molecular formula C26H24Cl2N2O and a molecular weight of 451.40 g/mol. Its IUPAC name is (E)-1-[4-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 143237622 |
| Molecular Formula | C26H24Cl2N2O |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (E)-1-[4-(4-chloro-2-methylphenyl)-3-(4-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1cc(Cl)ccc1N1CCN(C(=O)/C=C/c2ccccc2)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24Cl2N2O/c1-19-17-23(28)12-13-24(19)30-16-15-29(18-25(30)21-8-10-22(27)11-9-21)26(31)14-7-20-5-3-2-4-6-20/h2-14,17,25H,15-16,18H2,1H3/b14-7+ |
| InChIKey | IIEVSBHTCIYQSD-VGOFMYFVSA-N |
| XLogP | 6.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|