C27H22Cl3N3O — CID 59261845
(E)-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-(1H-indol-3-yl)prop-2-en-1-one (PubChem CID 59261845) has the molecular formula C27H22Cl3N3O and a molecular weight of 510.85 g/mol. Its IUPAC name is (E)-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-(1H-indol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-(1H-indol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59261845 |
| Molecular Formula | C27H22Cl3N3O |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | (E)-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-(1H-indol-3-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c[nH]c2ccccc12)N1CCN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C27H22Cl3N3O/c28-20-8-5-18(6-9-20)26-17-32(13-14-33(26)25-11-10-21(29)15-23(25)30)27(34)12-7-19-16-31-24-4-2-1-3-22(19)24/h1-12,15-16,26,31H,13-14,17H2/b12-7+ |
| InChIKey | ODEVPFMVASGFNA-KPKJPENVSA-N |
| XLogP | 7.23 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|