C23H19Cl3N2OS — CID 59261866
(E)-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 59261866) has the molecular formula C23H19Cl3N2OS and a molecular weight of 477.84 g/mol. Its IUPAC name is (E)-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 59261866 |
| Molecular Formula | C23H19Cl3N2OS |
| Molecular Weight | 477.84 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | (E)-1-[3-(4-chlorophenyl)-4-(2,4-dichlorophenyl)piperazin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)N1CCN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H19Cl3N2OS/c24-17-5-3-16(4-6-17)22-15-27(23(29)10-8-19-2-1-13-30-19)11-12-28(22)21-9-7-18(25)14-20(21)26/h1-10,13-14,22H,11-12,15H2/b10-8+ |
| InChIKey | SIDAQGGRLXTBDP-CSKARUKUSA-N |
| XLogP | 6.81 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.84 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|