C19H19Cl2N3O3 — CID 166034025
3-[4-(2-amino-4-chlorophenyl)-3-(4-chlorophenyl)piperazin-1-yl]-3-oxopropanoic acid (PubChem CID 166034025) has the molecular formula C19H19Cl2N3O3 and a molecular weight of 408.29 g/mol. Its IUPAC name is 3-[4-(2-amino-4-chlorophenyl)-3-(4-chlorophenyl)piperazin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[4-(2-amino-4-chlorophenyl)-3-(4-chlorophenyl)piperazin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 166034025 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-[4-(2-amino-4-chlorophenyl)-3-(4-chlorophenyl)piperazin-1-yl]-3-oxopropanoic acid |
| SMILES | Nc1cc(Cl)ccc1N1CCN(C(=O)CC(=O)O)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O3/c20-13-3-1-12(2-4-13)17-11-23(18(25)10-19(26)27)7-8-24(17)16-6-5-14(21)9-15(16)22/h1-6,9,17H,7-8,10-11,22H2,(H,26,27) |
| InChIKey | YQXDPYHVQPTHNN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|