C22H22Cl2N2O3 — CID 166034020
3-[(3R,5S)-3,4-bis(4-chlorophenyl)-5-cyclopropylpiperazin-1-yl]-3-oxopropanoic acid (PubChem CID 166034020) has the molecular formula C22H22Cl2N2O3 and a molecular weight of 433.34 g/mol. Its IUPAC name is 3-[(3R,5S)-3,4-bis(4-chlorophenyl)-5-cyclopropylpiperazin-1-yl]-3-oxopropanoic acid.
| Compound Name | 3-[(3R,5S)-3,4-bis(4-chlorophenyl)-5-cyclopropylpiperazin-1-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 166034020 |
| Molecular Formula | C22H22Cl2N2O3 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-[(3R,5S)-3,4-bis(4-chlorophenyl)-5-cyclopropylpiperazin-1-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N1C[C@H](C2CC2)N(c2ccc(Cl)cc2)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H22Cl2N2O3/c23-16-5-3-15(4-6-16)20-13-25(21(27)11-22(28)29)12-19(14-1-2-14)26(20)18-9-7-17(24)8-10-18/h3-10,14,19-20H,1-2,11-13H2,(H,28,29)/t19-,20+/m1/s1 |
| InChIKey | SMEWYFLMSPPPJX-UXHICEINSA-N |
| XLogP | 4.64 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|