C24H30FN3O3 — CID 119040394
tert-butyl 3-(3-fluorophenyl)-4-(4-pyridin-2-ylbutanoyl)piperazine-1-carboxylate (PubChem CID 119040394) has the molecular formula C24H30FN3O3 and a molecular weight of 427.52 g/mol. Its IUPAC name is tert-butyl 3-(3-fluorophenyl)-4-(4-pyridin-2-ylbutanoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-fluorophenyl)-4-(4-pyridin-2-ylbutanoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 119040394 |
| Molecular Formula | C24H30FN3O3 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | tert-butyl 3-(3-fluorophenyl)-4-(4-pyridin-2-ylbutanoyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCCc2ccccn2)C(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H30FN3O3/c1-24(2,3)31-23(30)27-14-15-28(21(17-27)18-8-6-9-19(25)16-18)22(29)12-7-11-20-10-4-5-13-26-20/h4-6,8-10,13,16,21H,7,11-12,14-15,17H2,1-3H3 |
| InChIKey | JVAVVIAPCNKTKB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |