C19H16N2O4S — CID 100735758
N-(2-oxochromen-3-yl)-2-[(3S)-thiolan-3-yl]oxypyridine-3-carboxamide (PubChem CID 100735758) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-(2-oxochromen-3-yl)-2-[(3S)-thiolan-3-yl]oxypyridine-3-carboxamide.
| Compound Name | N-(2-oxochromen-3-yl)-2-[(3S)-thiolan-3-yl]oxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 100735758 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-(2-oxochromen-3-yl)-2-[(3S)-thiolan-3-yl]oxypyridine-3-carboxamide |
| SMILES | O=C(Nc1cc2ccccc2oc1=O)c1cccnc1O[C@H]1CCSC1 |
| InChI | InChI=1S/C19H16N2O4S/c22-17(14-5-3-8-20-18(14)24-13-7-9-26-11-13)21-15-10-12-4-1-2-6-16(12)25-19(15)23/h1-6,8,10,13H,7,9,11H2,(H,21,22)/t13-/m0/s1 |
| InChIKey | ZEOQEZSRZGAPOV-ZDUSSCGKSA-N |
| XLogP | 3.32 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|