C20H21N3O2S — CID 124759918
N-(2-indol-1-ylethyl)-2-[(3R)-thiolan-3-yl]oxypyridine-3-carboxamide (PubChem CID 124759918) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(2-indol-1-ylethyl)-2-[(3R)-thiolan-3-yl]oxypyridine-3-carboxamide.
| Compound Name | N-(2-indol-1-ylethyl)-2-[(3R)-thiolan-3-yl]oxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 124759918 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(2-indol-1-ylethyl)-2-[(3R)-thiolan-3-yl]oxypyridine-3-carboxamide |
| SMILES | O=C(NCCn1ccc2ccccc21)c1cccnc1O[C@@H]1CCSC1 |
| InChI | InChI=1S/C20H21N3O2S/c24-19(17-5-3-9-22-20(17)25-16-8-13-26-14-16)21-10-12-23-11-7-15-4-1-2-6-18(15)23/h1-7,9,11,16H,8,10,12-14H2,(H,21,24)/t16-/m1/s1 |
| InChIKey | IKNVZTIQGGUWFI-MRXNPFEDSA-N |
| XLogP | 3.35 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |